CAS 1334177-87-5
:1-(Phenylmethyl) 5,8,11,14,17,20,23,26-octaoxa-2-azanonacosanedioate
Description:
1-(Phenylmethyl) 5,8,11,14,17,20,23,26-octaoxa-2-azanonacosanedioate, with the CAS number 1334177-87-5, is a complex organic compound characterized by its long carbon chain and multiple ether linkages due to the presence of eight oxygen atoms in its structure. The compound features a phenylmethyl group, which contributes to its aromatic properties, and a diester functional group, indicating that it can participate in various chemical reactions typical of esters. Its structure suggests potential applications in fields such as materials science, pharmaceuticals, or as a surfactant, owing to its amphiphilic nature. The presence of both hydrophilic (due to the ether and ester groups) and hydrophobic (due to the long carbon chain and phenyl group) regions may allow it to interact with different types of molecules, making it useful in formulations requiring solubilization or stabilization of various components. Additionally, the compound's stability and reactivity would depend on the specific conditions of use, including temperature, pH, and the presence of other reactive species.
Formula:C27H45NO12
InChI:InChI=1S/C27H45NO12/c29-26(30)6-8-32-10-12-34-14-16-36-18-20-38-22-23-39-21-19-37-17-15-35-13-11-33-9-7-28-27(31)40-24-25-4-2-1-3-5-25/h1-5H,6-24H2,(H,28,31)(H,29,30)
InChI key:InChIKey=ISVOBOLHCFBPFZ-UHFFFAOYSA-N
SMILES:C(OC(NCCOCCOCCOCCOCCOCCOCCOCCOCCC(O)=O)=O)C1=CC=CC=C1
Synonyms:- 1-(Phenylmethyl) 5,8,11,14,17,20,23,26-octaoxa-2-azanonacosanedioate
- 5,8,11,14,17,20,23,26-Octaoxa-2-azanonacosanedioic acid, 1-(phenylmethyl) ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Benzyloxycarbonylamino-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oic acid
CAS:Formula:C27H45NO12Purity:95%Color and Shape:SolidMolecular weight:575.6457Cbz-NH-PEG8-C2-acid
CAS:Cbz-NH-PEG8-C2-acid is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.Formula:C27H45NO12Color and Shape:SolidMolecular weight:575.653-Oxo-1-phenyl-2,7,10,13,16,19,22,25,28-nonaoxa-4-azahentriacontan-31-oic acid
CAS:Purity:95%Molecular weight:575.6519775m-dPEG®7-Tosylate
CAS:<p>m-dPEG®7-Tosylate is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. m-dPEG®7-Tosylate is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.</p>Formula:C27H45NO12Purity:Min. 95%Molecular weight:575.65 g/mol




