
CAS 1334178-04-9
:Poly(oxy-1,2-ethanediyl), α-hydro-ω-hydroxy-, ether with 31-hydroxy-23,23-bis[[3-[(2-hydroxyethyl)amino]-3-oxopropoxy]methyl]-5,21,28-trioxo-9,12,15,18,25-pentaoxa-6,22,29-triazahentriacontanoic acid (3:1)
Description:
Poly(oxy-1,2-ethanediyl), α-hydro-ω-hydroxy-, ether with 31-hydroxy-23,23-bis[[3-[(2-hydroxyethyl)amino]-3-oxopropoxy]methyl]-5,21,28-trioxo-9,12,15,18,25-pentaoxa-6,22,29-triazahentriacontanoic acid (3:1), identified by CAS number 1334178-04-9, is a complex polymeric compound characterized by its amphiphilic nature, which arises from the presence of both hydrophilic and hydrophobic segments. This structure allows it to function effectively as a surfactant or emulsifier in various applications, including pharmaceuticals and cosmetics. The polymer features multiple hydroxyl groups, contributing to its solubility in water and potential for forming hydrogen bonds, enhancing its interaction with biological systems. Additionally, the presence of triazole and ether linkages in its backbone may impart stability and resistance to degradation. Its intricate design suggests potential utility in drug delivery systems, where controlled release and biocompatibility are essential. Overall, this compound exemplifies the versatility of polymer chemistry in creating materials tailored for specific functional applications.
Formula:(C2H4O)n(C2H4O)n(C2H4O)nC35H65N5O17
Synonyms:- Poly(oxy-1,2-ethanediyl), α-hydro-ω-hydroxy-, ether with 31-hydroxy-23,23-bis[[3-[(2-hydroxyethyl)amino]-3-oxopropoxy]methyl]-5,21,28-trioxo-9,12,15,18,25-pentaoxa-6,22,29-triazahentriacontanoic acid (3:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Carboxyl-dPEG®4-(m-dPEG®12)3
CAS:Carboxyl-dPEG®4-(m-dPEG®12)3 is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Carboxyl-dPEG®4-(m-dPEG®12)3 is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.
Purity:Min. 95%Molecular weight:2,323.73 g/mol
