CAS 133426-99-0

2,8-Diethyl imidazo[1,2-a]pyridine-2,8-dicarboxylate

Description:

2,8-Diethyl imidazo[1,2-a]pyridine-2,8-dicarboxylate is a chemical compound characterized by its imidazo[1,2-a]pyridine core structure, which features a fused ring system comprising both imidazole and pyridine functionalities. This compound contains two ethyl groups at the 2 and 8 positions of the imidazo ring, contributing to its hydrophobic properties and potentially influencing its biological activity. The presence of two carboxylate ester groups at the 2 and 8 positions enhances its reactivity and solubility in organic solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can be significant in biological systems. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2,8-Diethyl imidazo[1,2-a]pyridine-2,8-dicarboxylate is a versatile compound with potential applications in drug development and other chemical research fields.

Formula: C₁₃H₁₄N₂O₄

InChI: InChI=1S/C13H14N2O4/c1-3-18-12(16)9-6-5-7-15-8-10(14-11(9)15)13(17)19-4-2/h5-8H,3-4H2,1-2H3

InChI key: InChIKey=UILHKIXKQILPDY-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C=2N(C=C(C(OCC)=O)N2)C=CC1

Synonyms:

• Imidazo[1,2-a]pyridine-2,8-dicarboxylic acid, 2,8-diethyl ester
• 2,8-Diethyl imidazo[1,2-a]pyridine-2,8-dicarboxylate
• Imidazo[1,2-a]pyridine-2,8-dicarboxylic acid, diethyl ester