CymitQuimica logo

CAS 133427-00-6

:

Imidazo[1,2-a]pyridine-8-carboxylic acid, 2-methyl-, ethyl ester

Description:
Imidazo[1,2-a]pyridine-8-carboxylic acid, 2-methyl-, ethyl ester is a chemical compound characterized by its imidazo-pyridine structure, which features a fused ring system comprising both imidazole and pyridine moieties. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of nitrogen atoms in its rings. The ethyl ester functional group suggests that it may have moderate solubility in organic solvents and could participate in various chemical reactions, such as esterification or hydrolysis. The presence of the carboxylic acid moiety indicates potential for hydrogen bonding, which can influence its reactivity and interactions with biological targets. Additionally, compounds of this type may be investigated for pharmaceutical applications, particularly in the development of drugs targeting specific biological pathways. Overall, the unique structural features of imidazo[1,2-a]pyridine-8-carboxylic acid, 2-methyl-, ethyl ester contribute to its potential utility in medicinal chemistry and related fields.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c1-3-15-11(14)9-5-4-6-13-7-8(2)12-10(9)13/h4-7H,3H2,1-2H3
InChI key:InChIKey=DNOLHJVWJUNVPM-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=2N(C=C(C)N2)C=CC1
Synonyms:
  • Imidazo[1,2-a]pyridine-8-carboxylic acid, 2-methyl-, ethyl ester
  • Ethyl 2-methylimidazo[1,2-a]pyridine-8-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.