CAS 13343-26-5
:4-CHLORO DIPHENYL SULFIDE
Description:
4-Chloro diphenyl sulfide, with the CAS number 13343-26-5, is an organic compound characterized by the presence of a sulfur atom bonded to two phenyl groups and a chlorine atom attached to one of the phenyl rings. This compound typically appears as a solid and is known for its aromatic properties due to the phenyl groups. It is relatively stable under standard conditions but may undergo reactions typical of aromatic compounds, such as electrophilic substitution. The presence of the chlorine atom can influence its reactivity and solubility, making it more polar compared to its non-chlorinated analogs. 4-Chloro diphenyl sulfide is often used in various chemical syntheses and may serve as an intermediate in the production of other chemical compounds. Safety precautions are necessary when handling this substance, as it may pose health risks if inhaled or ingested, and appropriate measures should be taken to minimize exposure.
Formula:C12H9ClS
InChI:InChI=1/C12H9ClS/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9H
SMILES:c1ccc(cc1)Sc1ccc(cc1)Cl
Synonyms:- 4-Chlorodiphenylsulphide
- 1-Chloro-4-(Phenylsulfanyl)Benzene
- 4-CHLORO DIPHENYL SULFIDE
- (4-Chlorophenyl)(phenyl)sulfane
- Benzene, 1-chloro-4-(phenylthio)-
- 4-Chloro diphenyl su
- 1-Chloro-4-phenylsulfanylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.