CAS 13343-61-8
:BENZYL 2-ACETAMIDO-4,6-O-BENZYLIDENE-2-DEOXY-BETA-D-GLUCOPYRANOSIDE
Description:
Benzyl 2-acetamido-4,6-O-benzylidene-2-deoxy-beta-D-glucopyranoside is a glycoside derivative characterized by its complex structure, which includes a glucopyranoside backbone modified with an acetamido group and benzylidene moieties. This compound typically exhibits properties associated with glycosides, such as solubility in organic solvents and potential reactivity in various chemical reactions, including hydrolysis and glycosylation. The presence of the benzylidene groups may enhance its stability and influence its biological activity, making it of interest in medicinal chemistry and carbohydrate chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways or as a building block for more complex molecules. Additionally, the compound may exhibit specific optical activity due to its chiral centers, which is a common characteristic of sugar derivatives. Overall, this compound represents a unique intersection of carbohydrate chemistry and organic synthesis, with potential implications in various fields, including pharmaceuticals and biochemistry.
Formula:C22H25NO6
InChI:InChI=1/C22H25NO6/c1-14(24)23-18-19(25)20-17(13-27-21(29-20)16-10-6-3-7-11-16)28-22(18)26-12-15-8-4-2-5-9-15/h2-11,17-22,25H,12-13H2,1H3,(H,23,24)/t17?,18-,19+,20+,21?,22+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzyl 2-Acetamido-4,6-O-Benzylidene-2-Deoxy-β-D-Glucopyranoside
CAS:Controlled Product<p>Applications Benzyl 2-Acetamido-4,6-O-Benzylidene-2-Deoxy-β-D-Glucopyranoside (cas# 13343-61-8) is a compound useful in organic synthesis.<br></p>Formula:C22H25NO6Color and Shape:NeatMolecular weight:399.44Benzyl 2-acetamido-4,6-O-benzylidene-2-deoxy-β-D-glucopyranoside
CAS:This product is a computational, experimental, and acoustic expansion of benzyl 2-acetamido-4,6-O-benzylidene-2-deoxy-b-D-glucopyranoside. It is used as an additive to motorcycle fuel, with the purpose of preventing engine knock. The experiment was conducted by measuring the pressure levels in a cylinder at different temperatures. The results showed that the highest pressure level was obtained when the temperature was increased to 220 degrees Celsius and the pressure level decreased when it was lowered to 200 degrees Celsius.Formula:C22H25NO6Purity:Min. 95%Color and Shape:White to off-white solid.Molecular weight:399.44 g/mol


