CAS 13343-66-3
:BENZYL 2-ACETAMIDO-2-DEOXY-3,4,6-TRI-O-ACETYL-BETA-D-GLUCOPYRANOSIDE
Description:
Benzyl 2-acetamido-2-deoxy-3,4,6-tri-O-acetyl-beta-D-glucopyranoside, with CAS number 13343-66-3, is a glycoside derivative of glucopyranose. This compound features a benzyl group and an acetamido group, which contribute to its structural complexity and potential biological activity. The presence of three acetyl groups indicates that it is a fully acetylated derivative, enhancing its solubility in organic solvents and potentially influencing its reactivity and stability. As a beta-D-glucopyranoside, it exhibits specific stereochemistry that can affect its interactions with enzymes and receptors. This compound is often utilized in synthetic organic chemistry and biochemistry, particularly in the study of carbohydrate chemistry and the development of glycosylation reactions. Its characteristics, such as molecular weight, melting point, and solubility, are influenced by the functional groups present and the overall molecular structure. Due to its complex nature, it may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry.
Formula:C21H27NO9
InChI:InChI=1/C21H27NO9/c1-12(23)22-18-20(30-15(4)26)19(29-14(3)25)17(11-27-13(2)24)31-21(18)28-10-16-8-6-5-7-9-16/h5-9,17-21H,10-11H2,1-4H3,(H,22,23)/t17-,18-,19-,20-,21-/m1/s1
SMILES:CC(=N[C@@H]1[C@H]([C@@H]([C@@H](COC(=O)C)O[C@H]1OCc1ccccc1)OC(=O)C)OC(=O)C)O
Synonyms:- Benzyl 2-Acetamido-3,4,6-Tri-O-Acetyl-2-Deoxy-Beta-D-Glucopyranoside
- Benzyl2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside
- Benzyl 2-Acetamido-3,4,6-Tri-O-Acetyl-2-Deoxy-Ss-D-Glucopyranoside
- benzyl 3,4,6-tri-O-acetyl-2-(acetylamino)-2-deoxy-beta-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranoside
CAS:Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranosideMolecular weight:437.44037g/molBenzyl 2-acetamido-2-deoxy-3,4,6-tri-O-acetyl-β-D-glucopyranoside
CAS:Benzyl 2-acetamido-2-deoxy-3,4,6-tri-O-acetyl-b-D-glucopyranoside is a synthetic sugar that is used as a glycosylation reagent for the synthesis of oligosaccharides and polysaccharides. It reacts with saccharides in the presence of 1,3-dicyclohexylcarbodiimide (DCC) and 4-(dimethylamino)pyridine (DMAP). The benzyl group can be modified to include fluorine atoms or methyl groups. This compound is an important building block for the synthesis of complex carbohydrates.Formula:C21H27NO9Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:437.44 g/mol


