
CAS 13343-95-8
:1-(2-Furanyl)-3-(2-thienyl)-2-propen-1-one
Description:
1-(2-Furanyl)-3-(2-thienyl)-2-propen-1-one, also known as a chalcone derivative, is an organic compound characterized by its unique structure that includes a furan ring and a thiophene ring attached to a propenone moiety. This compound typically exhibits a yellow to orange color and is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. The presence of the furan and thiophene rings contributes to its reactivity and ability to participate in various chemical reactions, such as Michael additions and condensation reactions. Additionally, chalcones are often studied for their role in medicinal chemistry, as they can serve as precursors for the synthesis of more complex molecules. The compound's solubility may vary depending on the solvent, and it is generally stable under standard laboratory conditions. Its applications can extend to fields such as pharmaceuticals, agrochemicals, and materials science, making it a compound of interest in both research and industrial contexts.
Formula:C11H8O2S
InChI:InChI=1S/C11H8O2S/c12-10(11-4-1-7-13-11)6-5-9-3-2-8-14-9/h1-8H
InChI key:InChIKey=HIBLXINPOYYHFI-UHFFFAOYSA-N
SMILES:C(C=CC1=CC=CS1)(=O)C2=CC=CO2
Synonyms:- 2-Propen-1-one, 1-(2-furanyl)-3-(2-thienyl)-
- 1-(2-Furanyl)-3-(2-thienyl)-2-propen-1-one
- 2-Propen-1-one, 1-(2-furyl)-3-(2-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.