CAS 1334337-31-3

6-Chloro-2-methoxy-9H-purine

Description:

6-Chloro-2-methoxy-9H-purine is a purine derivative characterized by the presence of a chlorine atom at the 6-position and a methoxy group at the 2-position of the purine ring. This compound typically exhibits properties common to purines, such as being a heterocyclic aromatic organic compound. It is likely to be a white to off-white solid, soluble in polar organic solvents, and may have moderate stability under standard conditions. The presence of the chlorine atom can influence its reactivity and biological activity, potentially making it a candidate for pharmaceutical applications. The methoxy group may enhance its lipophilicity, affecting its interaction with biological membranes. Additionally, compounds like this can be of interest in medicinal chemistry for their potential roles as antiviral or anticancer agents, given the biological significance of purine derivatives. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₆H₅ClN₄O

InChI: InChI=1S/C6H5ClN4O/c1-12-6-10-4(7)3-5(11-6)9-2-8-3/h2H,1H3,(H,8,9,10,11)

InChI key: InChIKey=MXUHLLULGWZJBG-UHFFFAOYSA-N

SMILES: ClC1=C2C(=NC(OC)=N1)N=CN2

Synonyms:

• 6-Chloro-2-methoxy-9H-purine
• 9H-Purine, 6-chloro-2-methoxy-

Clofarabine Impurity 2

CAS: 1334337-31-3

Formula: C₆H₅ClN₄O

Molecular weight: 184.6

Ref: ST-EA-CP-C83008