
CAS 1334405-54-7
:4-Bromo-3-chlorobenzo[b]thiophene
Description:
4-Bromo-3-chlorobenzo[b]thiophene is a heterocyclic aromatic compound characterized by the presence of both bromine and chlorine substituents on a benzo[b]thiophene ring system. This compound features a fused benzene and thiophene structure, which contributes to its unique electronic properties and potential reactivity. The presence of halogen atoms, specifically bromine and chlorine, can influence its chemical behavior, including its reactivity in electrophilic substitution reactions and its potential as a building block in organic synthesis. The compound may exhibit interesting photophysical properties, making it of interest in materials science and organic electronics. Additionally, its structural features may confer biological activity, warranting investigation for potential pharmaceutical applications. As with many halogenated compounds, considerations regarding environmental impact and toxicity are important, particularly in terms of persistence and bioaccumulation. Overall, 4-Bromo-3-chlorobenzo[b]thiophene represents a versatile compound with applications in various fields, including organic chemistry, materials science, and medicinal chemistry.
Formula:C8H4BrClS
InChI:InChI=1S/C8H4BrClS/c9-5-2-1-3-7-8(5)6(10)4-11-7/h1-4H
InChI key:InChIKey=LBLGAKOOTNWCKV-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC=C1)SC=C2Cl
Synonyms:- 4-Bromo-3-chlorobenzo[b]thiophene
- Benzo[b]thiophene, 4-bromo-3-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.