
CAS 1334405-61-6
:α,1-Dimethyl-1H-indazole-4-methanol
Description:
α,1-Dimethyl-1H-indazole-4-methanol is a chemical compound characterized by its indazole core structure, which is a five-membered ring containing two nitrogen atoms. This compound features two methyl groups attached to the first carbon of the indazole ring and a hydroxymethyl group at the fourth position. The presence of these functional groups contributes to its unique chemical properties, including potential solubility in organic solvents and reactivity in various chemical reactions. The compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure allows for interactions with biological targets, which could lead to therapeutic applications. As with many organic compounds, the stability and reactivity of α,1-Dimethyl-1H-indazole-4-methanol can be influenced by environmental factors such as pH, temperature, and the presence of other chemicals. Safety data and handling precautions should be considered when working with this substance, as with any chemical compound.
Formula:C10H12N2O
InChI:InChI=1S/C10H12N2O/c1-7(13)8-4-3-5-10-9(8)6-11-12(10)2/h3-7,13H,1-2H3
InChI key:InChIKey=FLGUHGLQYCNEFN-UHFFFAOYSA-N
SMILES:C(C)(O)C1=C2C(N(C)N=C2)=CC=C1
Synonyms:- 1H-Indazole-4-methanol, α,1-dimethyl-
- α,1-Dimethyl-1H-indazole-4-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.