CAS 1334405-62-7

α,1-Dimethyl-1H-indazole-6-methanol

Description:

α,1-Dimethyl-1H-indazole-6-methanol is a chemical compound characterized by its indazole core structure, which is a five-membered ring containing two nitrogen atoms. This compound features two methyl groups attached to the first carbon of the indazole ring and a hydroxymethyl group at the sixth position. The presence of these functional groups contributes to its potential biological activity and solubility properties. Typically, compounds like this may exhibit various pharmacological effects, making them of interest in medicinal chemistry. The molecular structure suggests that it could participate in hydrogen bonding due to the hydroxymethyl group, influencing its interactions with biological targets. Additionally, the dimethyl substitution may affect its lipophilicity and overall reactivity. As with many indazole derivatives, the compound may be investigated for its potential applications in drug development or as a research tool in biochemical studies. However, specific biological activities and safety profiles would require further empirical investigation and characterization.

Formula: C₁₀H₁₂N₂O

InChI: InChI=1S/C10H12N2O/c1-7(13)8-3-4-9-6-11-12(2)10(9)5-8/h3-7,13H,1-2H3

InChI key: InChIKey=JOCKMHUJVCRLAL-UHFFFAOYSA-N

SMILES: CN1C=2C(=CC=C(C(C)O)C2)C=N1

Synonyms:

• α,1-Dimethyl-1H-indazole-6-methanol
• 1H-Indazole-6-methanol, α,1-dimethyl-