
CAS 1334412-36-0
:3,3-Difluoro-N-methyl-4-piperidinamine
Description:
3,3-Difluoro-N-methyl-4-piperidinamine is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of two fluorine atoms at the 3-position and a methyl group at the nitrogen atom contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in polar organic solvents, which is common for amines, and may exhibit basic properties due to the presence of the amine functional group. The difluoromethyl substituents can influence its reactivity and interaction with biological systems, making it of interest in medicinal chemistry and drug development. Additionally, the compound's structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals, although specific applications would depend on further research into its biological activity and safety profile. As with all chemical substances, handling should be conducted with appropriate safety measures due to potential toxicity or reactivity.
Formula:C6H12F2N2
InChI:InChI=1S/C6H12F2N2/c1-9-5-2-3-10-4-6(5,7)8/h5,9-10H,2-4H2,1H3
InChI key:InChIKey=SUDTXEUYOBGYEY-UHFFFAOYSA-N
SMILES:N(C)C1C(F)(F)CNCC1
Synonyms:- 4-Piperidinamine, 3,3-difluoro-N-methyl-
- 3,3-Difluoro-N-methyl-4-piperidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.