CAS 133447-37-7
:1-(3,4-Dihydro-2H-pyrrol-5-yl)-1-propanone
Description:
1-(3,4-Dihydro-2H-pyrrol-5-yl)-1-propanone, with the CAS number 133447-37-7, is an organic compound characterized by its unique structure that includes a pyrrole ring fused with a propanone moiety. This compound typically exhibits properties associated with both ketones and nitrogen-containing heterocycles. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the pyrrole ring suggests potential reactivity, particularly in electrophilic substitution reactions, and may also influence its solubility in various organic solvents. The compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrrole derivatives. Additionally, its molecular structure may allow for interactions with biological targets, making it of interest in drug design and synthesis. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C7H11NO
InChI:InChI=1S/C7H11NO/c1-2-7(9)6-4-3-5-8-6/h2-5H2,1H3
InChI key:InChIKey=OVNCGQSYSSYBPO-UHFFFAOYSA-N
SMILES:C(CC)(=O)C=1CCCN1
Synonyms:- 1-(3,4-Dihydro-2H-pyrrol-5-yl)-1-propanone
- 1-(3,4-dihydro-2H-pyrrol-5-yl)propan-1-one
- 1-Propanone, 1-(3,4-dihydro-2H-pyrrol-5-yl)-
- 1-Propanone,1-(3,4-dihydro-2H-pyrrol-5-yl)-(9CI)
- 2-Propionylpyrroline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
