CAS 133448-23-4
:L-Argininamide, N-[(1,1-dimethylethoxy)carbonyl]glycyl-L-lysyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-, monohydrochloride
Description:
L-Argininamide, N-[(1,1-dimethylethoxy)carbonyl]glycyl-L-lysyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-, monohydrochloride is a complex organic compound characterized by its multi-functional structure, which includes amino acid derivatives and a benzopyran moiety. This compound features a combination of arginine and lysine residues, which are essential amino acids known for their roles in protein synthesis and metabolic processes. The presence of the dimethylethoxycarbonyl group suggests potential applications in protecting functional groups during synthesis. The benzopyran component may impart additional biological activity, possibly related to antioxidant properties. As a hydrochloride salt, it is likely to exhibit improved solubility in aqueous solutions, making it suitable for various biochemical applications. The compound's intricate structure indicates potential utility in pharmaceutical research, particularly in the development of peptide-based therapeutics or as a biochemical probe. However, specific biological activities, stability, and reactivity would require further investigation through empirical studies.
Formula:C29H44N8O7·ClH
InChI:InChI=1S/C29H44N8O7.ClH/c1-17-14-24(39)43-22-15-18(10-11-19(17)22)35-25(40)21(9-7-13-33-27(31)32)37-26(41)20(8-5-6-12-30)36-23(38)16-34-28(42)44-29(2,3)4;/h10-11,14-15,20-21H,5-9,12-13,16,30H2,1-4H3,(H,34,42)(H,35,40)(H,36,38)(H,37,41)(H4,31,32,33);1H/t20-,21-;/m0./s1
InChI key:InChIKey=UAHPBUDRCWAHCH-GUTACTQSSA-N
SMILES:CC=1C=2C(=CC(NC([C@@H](NC([C@@H](NC(CNC(OC(C)(C)C)=O)=O)CCCCN)=O)CCCNC(=N)N)=O)=CC2)OC(=O)C1.Cl
Synonyms:- <span class="text-smallcaps">L</smallcap>-Argininamide, N-[(1,1-dimethylethoxy)carbonyl]glycyl-<smallcap>L</span>-lysyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-, monohydrochloride
- Boc-Gly-Lys-Arg-AMC . HCl
- N-T-Boc-Gly-Lys-Arg 7-Amido-4-Methylcoumarin Hydrochloride
- 559: PN: US20220128567 SEQID: 1237 claimed sequence
- L-Argininamide, N-[(1,1-dimethylethoxy)carbonyl]glycyl-L-lysyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-, monohydrochloride
- 1229: PN: WO2023172654 SEQID: 1237 claimed sequence
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Boc-Gly-Lys-Arg-AMC · HCl
CAS:Boc-GKR-AMC, a substrate for the Kex2 endoprotease (kexin, previously known as proteinase yscF), a membrane-bound, calcium-dependent serine protease from yeast α-cells.Formula:C29H44N8O7·HClPurity:97.1%Color and Shape:White PowderMolecular weight:653.18Boc-Gly-Lys-Arg-AMC·HCl
CAS:Boc-Gly-Lys-Arg-AMC·HCl is a versatile building block for the synthesis of diverse and complex compounds. It is a high quality, useful intermediate that can be used as a reaction component or scaffold to synthesize more complex molecules. Boc-Gly-Lys-Arg-AMC·HCl has been shown to be useful in the synthesis of pharmaceuticals, agrochemicals, and other specialized chemicals.
Formula:C29H44N8O7·HClPurity:Min. 97 Area-%Color and Shape:PowderMolecular weight:653.17 g/molRef: 3D-FB110556
Discontinued product

