CymitQuimica logo

CAS 1334487-59-0

:

3-Phenylpyrazolo[1,5-a]pyrimidine-2,7(1H,4H)-dione

Description:
3-Phenylpyrazolo[1,5-a]pyrimidine-2,7(1H,4H)-dione is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings, which contribute to its unique chemical properties. This compound typically exhibits a solid-state form and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of the phenyl group enhances its lipophilicity, potentially influencing its interaction with biological targets. The dione functional groups suggest the presence of keto functionalities, which can participate in hydrogen bonding and may play a role in the compound's reactivity and stability. Additionally, the structural arrangement allows for various substitution patterns, which can be explored to modify its pharmacological properties. Overall, 3-Phenylpyrazolo[1,5-a]pyrimidine-2,7(1H,4H)-dione represents a class of compounds that may exhibit diverse biological activities, warranting further investigation for potential therapeutic applications.
Formula:C12H9N3O2
InChI:InChI=1S/C12H9N3O2/c16-9-6-7-13-11-10(12(17)14-15(9)11)8-4-2-1-3-5-8/h1-7,13H,(H,14,17)
InChI key:InChIKey=LPGLIOUQAHHKQV-UHFFFAOYSA-N
SMILES:O=C1C(=C2N(N1)C(=O)C=CN2)C3=CC=CC=C3
Synonyms:
  • Pyrazolo[1,5-a]pyrimidine-2,7(1H,4H)-dione, 3-phenyl-
  • 3-Phenylpyrazolo[1,5-a]pyrimidine-2,7(1H,4H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.