CymitQuimica logo

CAS 1334488-50-4

:

3-(Aminomethyl)-3-phenylcyclobutanol

Description:
3-(Aminomethyl)-3-phenylcyclobutanol is a chemical compound characterized by its unique cyclobutane structure, which features a phenyl group and an aminomethyl substituent. This compound is notable for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents and potentially influencing its biological activity. The cyclobutane ring contributes to the compound's rigidity, which can affect its conformational properties and reactivity. Additionally, the phenyl group may provide aromatic characteristics, influencing the compound's electronic properties and interactions with other molecules. Overall, 3-(Aminomethyl)-3-phenylcyclobutanol represents a fascinating subject for further research, particularly in the context of drug design and synthesis, where its structural features may be leveraged to develop novel therapeutic agents.
Formula:C11H15NO
InChI:InChI=1S/C11H15NO/c12-8-11(6-10(13)7-11)9-4-2-1-3-5-9/h1-5,10,13H,6-8,12H2
InChI key:InChIKey=KWUZIPWWIRIQAG-UHFFFAOYSA-N
SMILES:C(N)C1(CC(O)C1)C2=CC=CC=C2
Synonyms:
  • 3-(Aminomethyl)-3-phenylcyclobutanol
  • Cyclobutanol, 3-(aminomethyl)-3-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.