CAS 1334493-08-1

1-(1,1-Dimethylethyl) 3-(4-carboxy-5-methyl-1H-1,2,3-triazol-1-yl)-1-piperidinecarboxylate

Description:

1-(1,1-Dimethylethyl) 3-(4-carboxy-5-methyl-1H-1,2,3-triazol-1-yl)-1-piperidinecarboxylate, with CAS number 1334493-08-1, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a triazole moiety, and a tert-butyl group. The presence of the carboxylic acid functional group in the triazole enhances its potential for forming hydrogen bonds, which may contribute to its solubility and reactivity. This compound is likely to exhibit biological activity due to the triazole ring, which is known for its role in various pharmacological applications, including as antifungal agents. The tert-butyl group provides steric hindrance, which can influence the compound's interaction with biological targets. Additionally, the overall molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties would be assessed through various analytical methods such as NMR, mass spectrometry, and chromatography.

Formula: C₁₄H₂₂N₄O₄

InChI: InChI=1S/C14H22N4O4/c1-9-11(12(19)20)15-16-18(9)10-6-5-7-17(8-10)13(21)22-14(2,3)4/h10H,5-8H2,1-4H3,(H,19,20)

InChI key: InChIKey=SHQZUNGEKWWFJT-UHFFFAOYSA-N

SMILES: CC=1N(N=NC1C(O)=O)C2CN(C(OC(C)(C)C)=O)CCC2

Synonyms:

• 3-(4-Carboxy-5-methyl-[1,2,3]triazol-1-yl)-piperidine-1-carboxylic acid tert-butyl ester
• 1-Piperidinecarboxylic acid, 3-(4-carboxy-5-methyl-1H-1,2,3-triazol-1-yl)-, 1-(1,1-dimethylethyl) ester
• 1-(1,1-Dimethylethyl) 3-(4-carboxy-5-methyl-1H-1,2,3-triazol-1-yl)-1-piperidinecarboxylate
• 5-Methyl-1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]triazole-4-carboxylic acid