CAS 1334499-56-7

1,1-Dimethylethyl 1,5-diazaspiro[3.4]octane-1-carboxylate

Description:

1,1-Dimethylethyl 1,5-diazaspiro[3.4]octane-1-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen atoms and a carboxylate functional group. The presence of the 1,1-dimethylethyl group contributes to its steric bulk, potentially influencing its reactivity and interactions with other molecules. The diazaspiro framework suggests that the compound may exhibit interesting conformational properties, which could affect its biological activity or chemical behavior. As a carboxylate, it may participate in various chemical reactions, including esterification and nucleophilic substitutions. The compound's CAS number, 1334499-56-7, allows for precise identification in chemical databases. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature often exhibit moderate to low solubility in polar solvents and may have distinct spectral characteristics in NMR and IR spectroscopy. Overall, the structural features of this compound suggest potential applications in medicinal chemistry or as a building block in organic synthesis.

Formula: C₁₁H₂₀N₂O₂

InChI: InChI=1S/C11H20N2O2/c1-10(2,3)15-9(14)13-8-6-11(13)5-4-7-12-11/h12H,4-8H2,1-3H3

InChI key: InChIKey=BEABRSXJJQTIFZ-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C2(CC1)CCCN2

Synonyms:

• 1,1-Dimethylethyl 1,5-diazaspiro[3.4]octane-1-carboxylate
• 1,5-Diazaspiro[3.4]octane-1-carboxylic acid, 1,1-dimethylethyl ester