CymitQuimica logo

CAS 1334499-59-0

:

Phenylmethyl 1,5-diazaspiro[3.5]nonane-1-carboxylate

Description:
Phenylmethyl 1,5-diazaspiro[3.5]nonane-1-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework featuring two nitrogen atoms integrated into the ring system. This compound typically exhibits properties associated with both amines and esters due to the presence of the diaza moiety and the carboxylate functional group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as spiro compounds often exhibit interesting biological activities. The presence of the phenylmethyl group may enhance lipophilicity, influencing its interaction with biological membranes. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents on the spiro framework. Overall, Phenylmethyl 1,5-diazaspiro[3.5]nonane-1-carboxylate represents a class of compounds that may offer diverse chemical behavior and potential utility in various chemical and biological applications.
Formula:C15H20N2O2
InChI:InChI=1S/C15H20N2O2/c18-14(19-12-13-6-2-1-3-7-13)17-11-9-15(17)8-4-5-10-16-15/h1-3,6-7,16H,4-5,8-12H2
InChI key:InChIKey=ADVRPMHYMUXPSQ-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2C3(CC2)CCCCN3
Synonyms:
  • 1,5-Diazaspiro[3.5]nonane-1-carboxylic acid, phenylmethyl ester
  • Phenylmethyl 1,5-diazaspiro[3.5]nonane-1-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.