CAS 1334499-60-3

1,1-Dimethylethyl 1,6-diazaspiro[4.5]decane-1-carboxylate

Description:

1,1-Dimethylethyl 1,6-diazaspiro[4.5]decane-1-carboxylate, identified by its CAS number 1334499-60-3, is a chemical compound characterized by its unique spirocyclic structure, which includes a diaza (two nitrogen atoms) framework. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, which can influence its interactions with other molecules, potentially affecting its biological activity and stability. The spirocyclic nature of the compound often leads to interesting conformational properties, which can be significant in medicinal chemistry and drug design. Additionally, the nitrogen atoms in the diazaspiro structure may participate in hydrogen bonding, impacting the compound's solubility and reactivity. Overall, this compound's unique structural features suggest potential applications in various fields, including pharmaceuticals and materials science, although specific applications would depend on further research into its properties and behavior in different environments.

Formula: C₁₃H₂₄N₂O₂

InChI: InChI=1S/C13H24N2O2/c1-12(2,3)17-11(16)15-10-6-8-13(15)7-4-5-9-14-13/h14H,4-10H2,1-3H3

InChI key: InChIKey=ILIDUHJHDWXNSG-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C2(CCC1)CCCCN2

Synonyms:

• 1,1-Dimethylethyl 1,6-diazaspiro[4.5]decane-1-carboxylate
• 1,6-Diazaspiro[4.5]decane-1-carboxylic acid, 1,1-dimethylethyl ester