CAS 1334499-62-5

1,5-Diazaspiro[3.5]nonane, hydrochloride (1:2)

Description:

1,5-Diazaspiro[3.5]nonane, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which consists of two nitrogen atoms incorporated into a bicyclic framework. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the diaza (two nitrogen atoms) in the spiro structure contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The compound may exhibit various properties, including basicity due to the nitrogen atoms, which can participate in protonation reactions. Its specific applications and interactions depend on its molecular structure and the functional groups present. As with many nitrogen-containing heterocycles, it may also show potential as a ligand in coordination chemistry or as a building block in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.

Formula: C₇H₁₄N₂·2ClH

InChI: InChI=1S/C7H14N2.2ClH/c1-2-5-8-7(3-1)4-6-9-7;;/h8-9H,1-6H2;2*1H

InChI key: InChIKey=ZDNAZNPYQOBBAE-UHFFFAOYSA-N

SMILES: C12(CCN1)CCCCN2.Cl

Synonyms:

• 1,5-Diazaspiro[3.5]nonane, hydrochloride (1:2)