CAS 1334499-63-6

2,6-Diazaspiro[3.5]nonane, hydrochloride (1:2)

Description:

2,6-Diazaspiro[3.5]nonane, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework containing two nitrogen atoms in the diaza positions. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications, particularly in pharmaceutical research. The presence of the spiro structure contributes to its potential biological activity, as such configurations can influence the interaction with biological targets. The compound may exhibit properties such as moderate to high polarity due to the nitrogen atoms, which can participate in hydrogen bonding. Its hydrochloride form suggests that it can be used in formulations requiring stability and controlled release. As with many nitrogen-containing heterocycles, it may also display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₇H₁₄N₂·2ClH

InChI: InChI=1S/C7H14N2.2ClH/c1-2-7(4-8-3-1)5-9-6-7;;/h8-9H,1-6H2;2*1H

InChI key: InChIKey=LPEBBLQLQAGUHT-UHFFFAOYSA-N

SMILES: C12(CNC1)CCCNC2.Cl

Synonyms:

• 2,6-Diazaspiro[3.5]nonane, hydrochloride (1:2)

2,6-Diazaspiro[3.5]nonane dihydrochloride

CAS: 1334499-63-6

Formula: C₇H₁₆Cl₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 199.1213

Ref: IN-DA003G1Y

2,6-Diazaspiro[3.5]nonane dihydrochloride

CAS: 1334499-63-6

Purity: 95%

Molecular weight: 199.1199951

Ref: 10-F696091