CymitQuimica logo

CAS 1334499-64-7

:

2,5-Diazaspiro[3.5]nonane, hydrochloride (1:2)

Description:
2,5-Diazaspiro[3.5]nonane, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework containing two nitrogen atoms in its ring system. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of nitrogen atoms contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure allows for various interactions with biological targets, which may lead to applications in drug development. As with many nitrogen-containing compounds, it may exhibit basic properties, and its hydrochloride form indicates that it can form salts with acids. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity. Further studies are often required to fully elucidate its properties and potential applications in various fields.
Formula:C7H14N2·2ClH
InChI:InChI=1S/C7H14N2.2ClH/c1-2-4-9-7(3-1)5-8-6-7;;/h8-9H,1-6H2;2*1H
InChI key:InChIKey=SWBBWEUABZWWRV-UHFFFAOYSA-N
SMILES:C12(CNC1)CCCCN2.Cl
Synonyms:
  • 2,5-Diazaspiro[3.5]nonane, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.