
CAS 1334499-65-8
:1,6-Diazaspiro[3.5]nonane, hydrochloride (1:2)
Description:
1,6-Diazaspiro[3.5]nonane, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework containing two nitrogen atoms in the diazabicyclic portion. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of nitrogen atoms in the structure contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The compound may exhibit properties such as being a potential ligand for various biological targets, and its spirocyclic nature can influence its conformational flexibility and interaction with biological systems. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding and other interactions that are crucial for its reactivity and biological function. Safety and handling precautions should be observed, as with all chemical substances, particularly in research and industrial applications.
Formula:C7H14N2·2ClH
InChI:InChI=1S/C7H14N2.2ClH/c1-2-7(3-5-9-7)6-8-4-1;;/h8-9H,1-6H2;2*1H
InChI key:InChIKey=JALWUQQECGBQNK-UHFFFAOYSA-N
SMILES:C12(CCN1)CCCNC2.Cl
Synonyms:- 1,6-Diazaspiro[3.5]nonane, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.