CymitQuimica logo

CAS 1334499-75-0

:

Phenylmethyl 1,6-diazaspiro[3.5]nonane-6-carboxylate

Description:
Phenylmethyl 1,6-diazaspiro[3.5]nonane-6-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen atoms and a carboxylate functional group. The presence of the diaza moiety indicates that the compound contains two nitrogen atoms within its cyclic framework, contributing to its potential biological activity and interaction with various receptors. The phenylmethyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural complexity suggests potential applications in drug design, particularly in the development of novel therapeutics. Additionally, the carboxylate group can participate in various chemical reactions, potentially allowing for further derivatization. Overall, the characteristics of Phenylmethyl 1,6-diazaspiro[3.5]nonane-6-carboxylate make it a noteworthy compound for research in both synthetic and medicinal chemistry contexts.
Formula:C15H20N2O2
InChI:InChI=1S/C15H20N2O2/c18-14(19-11-13-5-2-1-3-6-13)17-10-4-7-15(12-17)8-9-16-15/h1-3,5-6,16H,4,7-12H2
InChI key:InChIKey=FYWRMMWCCNOBSJ-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC3(CCN3)CCC2
Synonyms:
  • Phenylmethyl 1,6-diazaspiro[3.5]nonane-6-carboxylate
  • 1,6-Diazaspiro[3.5]nonane-6-carboxylic acid, phenylmethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.