
CAS 1334499-76-1
:6-Bromo-5H-imidazo[2,1-b][1,3]oxazine
Description:
6-Bromo-5H-imidazo[2,1-b][1,3]oxazine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both imidazole and oxazine rings. This compound features a bromine substituent at the 6-position of the imidazole ring, contributing to its reactivity and potential biological activity. The presence of nitrogen and oxygen atoms in its structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its molecular framework allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological significance of imidazole derivatives. Additionally, the compound's properties, such as solubility, stability, and reactivity, can be influenced by the bromine atom, which may affect its interactions with biological targets. Overall, 6-Bromo-5H-imidazo[2,1-b][1,3]oxazine represents a class of compounds that are of interest for their potential therapeutic applications and their role in various chemical processes.
Formula:C6H5BrN2O
InChI:InChI=1S/C6H5BrN2O/c7-5-3-9-2-1-8-6(9)10-4-5/h1-2,4H,3H2
InChI key:InChIKey=HQZKKQXXEMFQOH-UHFFFAOYSA-N
SMILES:BrC=1CN2C(OC1)=NC=C2
Synonyms:- 5H-Imidazo[2,1-b][1,3]oxazine, 6-bromo-
- 6-Bromo-5H-imidazo[2,1-b][1,3]oxazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.