CymitQuimica logo

CAS 1334499-80-7

:

1,1-Dimethylethyl 1,5-diazaspiro[3.5]nonane-1-carboxylate

Description:
1,1-Dimethylethyl 1,5-diazaspiro[3.5]nonane-1-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen atoms and a carboxylate functional group. The presence of the 1,1-dimethylethyl group contributes to its steric bulk, influencing its reactivity and interaction with other molecules. This compound is likely to exhibit properties typical of spiro compounds, such as rigidity and potential chirality, depending on the specific stereochemistry of the substituents. The diazaspiro framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the nitrogen atoms that can participate in hydrogen bonding and coordination with biological targets. Additionally, the carboxylate group may enhance solubility in polar solvents and facilitate interactions with biological systems. Overall, the structural features of 1,1-Dimethylethyl 1,5-diazaspiro[3.5]nonane-1-carboxylate suggest it could be of interest in various chemical and biological applications, although specific reactivity and stability would depend on the surrounding conditions.
Formula:C12H22N2O2
InChI:InChI=1S/C12H22N2O2/c1-11(2,3)16-10(15)14-9-7-12(14)6-4-5-8-13-12/h13H,4-9H2,1-3H3
InChI key:InChIKey=IVVHXTOYWVMTKE-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C2(CC1)CCCCN2
Synonyms:
  • 1,1-Dimethylethyl 1,5-diazaspiro[3.5]nonane-1-carboxylate
  • 1,5-Diazaspiro[3.5]nonane-1-carboxylic acid, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.