
CAS 1334499-82-9
:Phenylmethyl 1,6-diazaspiro[3.5]nonane-1-carboxylate
Description:
Phenylmethyl 1,6-diazaspiro[3.5]nonane-1-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a diaza (two nitrogen atoms) framework and a carboxylate functional group. This compound features a phenylmethyl group, contributing to its aromatic properties and potential interactions in biological systems. The spirocyclic arrangement often imparts distinctive steric and electronic properties, making it of interest in medicinal chemistry and drug design. The presence of nitrogen atoms in the structure can enhance solubility and reactivity, while the carboxylate group may participate in hydrogen bonding and ionic interactions. Such characteristics suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are critical for its practical applications. Overall, the unique structural features of Phenylmethyl 1,6-diazaspiro[3.5]nonane-1-carboxylate make it a subject of interest for further research and development in various chemical and biological fields.
Formula:C15H20N2O2
InChI:InChI=1S/C15H20N2O2/c18-14(19-11-13-5-2-1-3-6-13)17-10-8-15(17)7-4-9-16-12-15/h1-3,5-6,16H,4,7-12H2
InChI key:InChIKey=PSWWJLDDNOFCJW-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2C3(CC2)CCCNC3
Synonyms:- 1,6-Diazaspiro[3.5]nonane-1-carboxylic acid, phenylmethyl ester
- Phenylmethyl 1,6-diazaspiro[3.5]nonane-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.