CymitQuimica logo

CAS 1334499-86-3

:

Ethyl 5-fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine-2-carboxylate

Description:
Ethyl 5-fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine-2-carboxylate is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both fluorine and iodine substituents. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity, while the iodine atom can provide unique reactivity due to its larger atomic size and ability to participate in various chemical transformations. The carboxylate moiety is significant for potential interactions in biological systems, making this compound of interest in medicinal chemistry and drug development. Its structural complexity and the presence of halogen atoms suggest potential applications in pharmaceuticals, particularly in the development of targeted therapies. As with many halogenated compounds, considerations regarding stability, reactivity, and environmental impact are essential in its handling and application.
Formula:C10H8FIN2O2
InChI:InChI=1S/C10H8FIN2O2/c1-2-16-10(15)8-7(12)6-3-5(11)4-13-9(6)14-8/h3-4H,2H2,1H3,(H,13,14)
InChI key:InChIKey=WHTZWVMGSRHIIE-UHFFFAOYSA-N
SMILES:IC=1C=2C(NC1C(OCC)=O)=NC=C(F)C2
Synonyms:
  • Ethyl 5-fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine-2-carboxylate
  • 1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 5-fluoro-3-iodo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.