CymitQuimica logo

CAS 1334499-88-5

:

Phenylmethyl 1,6-diazaspiro[4.5]decane-1-carboxylate

Description:
Phenylmethyl 1,6-diazaspiro[4.5]decane-1-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework containing nitrogen atoms. This compound belongs to a class of spiro compounds, which are known for their distinctive arrangement of atoms that can influence their chemical reactivity and biological activity. The presence of the phenylmethyl group contributes to its hydrophobic characteristics, while the diaza moiety introduces potential sites for hydrogen bonding and interaction with biological targets. The carboxylate functional group suggests that the compound may exhibit acidic properties, which can affect its solubility and reactivity in various environments. Additionally, the spiro structure can impart rigidity, potentially influencing the compound's conformational stability and interactions with other molecules. Overall, the unique structural features of Phenylmethyl 1,6-diazaspiro[4.5]decane-1-carboxylate may render it of interest in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.
Formula:C16H22N2O2
InChI:InChI=1S/C16H22N2O2/c19-15(20-13-14-7-2-1-3-8-14)18-12-6-10-16(18)9-4-5-11-17-16/h1-3,7-8,17H,4-6,9-13H2
InChI key:InChIKey=CGAJLTLGAIPAKP-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2C3(CCC2)CCCCN3
Synonyms:
  • 1,6-Diazaspiro[4.5]decane-1-carboxylic acid, phenylmethyl ester
  • Phenylmethyl 1,6-diazaspiro[4.5]decane-1-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.