
CAS 1334499-89-6
:Phenylmethyl 1,5-diazaspiro[3.4]octane-1-carboxylate
Description:
Phenylmethyl 1,5-diazaspiro[3.4]octane-1-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework featuring two nitrogen atoms integrated into the spiro system. This compound typically exhibits properties associated with both amines and esters due to the presence of the diaza (two nitrogen atoms) and carboxylate functional groups. The phenylmethyl group contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity. The spiro structure can impart rigidity to the molecule, which may affect its biological activity and interaction with other compounds. Such compounds are often of interest in medicinal chemistry for their potential pharmacological properties. The specific interactions and stability of this compound can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, Phenylmethyl 1,5-diazaspiro[3.4]octane-1-carboxylate represents a class of compounds that may have applications in drug development and materials science.
Formula:C14H18N2O2
InChI:InChI=1S/C14H18N2O2/c17-13(18-11-12-5-2-1-3-6-12)16-10-8-14(16)7-4-9-15-14/h1-3,5-6,15H,4,7-11H2
InChI key:InChIKey=FRUGSMZVONNNBU-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2C3(CC2)CCCN3
Synonyms:- Phenylmethyl 1,5-diazaspiro[3.4]octane-1-carboxylate
- 1,5-Diazaspiro[3.4]octane-1-carboxylic acid, phenylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.