CAS 1334499-93-2
:4′-Chloro-2′-methoxy[1,1′-biphenyl]-4-acetic acid
Description:
4′-Chloro-2′-methoxy[1,1′-biphenyl]-4-acetic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the para position and a methoxy group at the ortho position relative to the acetic acid moiety contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic biphenyl structure. The acetic acid functional group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification or amidation. Additionally, the presence of halogen and methoxy substituents can influence its reactivity and potential biological activity, making it of interest in pharmaceutical and agrochemical research. Overall, the compound's structural features suggest potential applications in medicinal chemistry and material science, although specific biological activities and interactions would require further investigation.
Formula:C15H13ClO3
InChI:InChI=1S/C15H13ClO3/c1-19-14-9-12(16)6-7-13(14)11-4-2-10(3-5-11)8-15(17)18/h2-7,9H,8H2,1H3,(H,17,18)
InChI key:InChIKey=YMWMOVWNRDSQRK-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(Cl)=C1)C2=CC=C(CC(O)=O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-acetic acid, 4′-chloro-2′-methoxy-
- 4′-Chloro-2′-methoxy[1,1′-biphenyl]-4-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
