CymitQuimica logo

CAS 1334499-97-6

:

3′-Chloro-5′-fluoro[1,1′-biphenyl]-4-acetic acid

Description:
3′-Chloro-5′-fluoro[1,1′-biphenyl]-4-acetic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 3′ position and a fluoro group at the 5′ position introduces halogen substituents that can significantly influence the compound's chemical reactivity and physical properties. The acetic acid functional group at the 4-position contributes to its acidity and potential for forming salts or esters. This compound may exhibit unique biological activity due to its structural features, making it of interest in pharmaceutical research. Its molecular interactions can be affected by the electron-withdrawing nature of the halogens, which can alter the compound's lipophilicity and solubility in various solvents. Additionally, the compound's stability, reactivity, and potential applications in synthesis or as a reagent can be influenced by these substituents. Overall, 3′-Chloro-5′-fluoro[1,1′-biphenyl]-4-acetic acid represents a versatile structure in organic chemistry with potential applications in various fields.
Formula:C14H10ClFO2
InChI:InChI=1S/C14H10ClFO2/c15-12-6-11(7-13(16)8-12)10-3-1-9(2-4-10)5-14(17)18/h1-4,6-8H,5H2,(H,17,18)
InChI key:InChIKey=KFFSYUUGAKFINH-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=C(F)C1)C2=CC=C(CC(O)=O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-4-acetic acid, 3′-chloro-5′-fluoro-
  • 3′-Chloro-5′-fluoro[1,1′-biphenyl]-4-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.