CAS 13345-11-4
:6-benzylpyrimidine-2,4(1H,3H)-dione
Description:
6-Benzylpyrimidine-2,4(1H,3H)-dione, with the CAS number 13345-11-4, is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a benzyl group and two carbonyl groups at the 2 and 4 positions. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents. Its structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the benzyl group can enhance lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, the diketone functionality may participate in various chemical reactions, such as nucleophilic additions or condensation reactions, which can be exploited in synthetic applications. The compound's reactivity and stability can vary based on environmental conditions, such as pH and temperature. Overall, 6-benzylpyrimidine-2,4(1H,3H)-dione serves as a valuable scaffold in drug discovery and development, particularly in the search for novel therapeutic agents.
Formula:C11H10N2O2
InChI:InChI=1/C11H10N2O2/c14-10-7-9(12-11(15)13-10)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,12,13,14,15)
SMILES:c1ccc(cc1)Cc1cc(nc(n1)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.