CAS 13345-12-5
:6-(2-phenylethyl)pyrimidine-2,4(1H,3H)-dione
Description:
6-(2-Phenylethyl)pyrimidine-2,4(1H,3H)-dione, identified by its CAS number 13345-12-5, is a chemical compound that features a pyrimidine ring substituted with a phenylethyl group and two carbonyl groups at the 2 and 4 positions. This compound is characterized by its potential biological activity, which may include interactions with various biological targets due to the presence of the pyrimidine moiety, a common structural element in many pharmaceuticals. The phenylethyl substituent can enhance lipophilicity, potentially influencing the compound's pharmacokinetics and bioavailability. Additionally, the diketone functionality may participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Overall, 6-(2-phenylethyl)pyrimidine-2,4(1H,3H)-dione represents a versatile structure with implications in medicinal chemistry and organic synthesis.
Formula:C12H12N2O2
InChI:InChI=1/C12H12N2O2/c15-11-8-10(13-12(16)14-11)7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,13,14,15,16)
SMILES:c1ccc(cc1)CCc1cc(nc(n1)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.