
CAS 13345-23-8
:1-Hydroxybenzo[a]pyrene
Description:
1-Hydroxybenzo[a]pyrene is a polycyclic aromatic hydrocarbon (PAH) that is recognized for its potential carcinogenic properties. It is a hydroxylated derivative of benzo[a]pyrene, which is a well-known environmental pollutant and a product of incomplete combustion of organic materials. The compound features a hydroxyl (-OH) group attached to the benzo[a]pyrene structure, influencing its solubility and reactivity. 1-Hydroxybenzo[a]pyrene is typically found in various environmental matrices, including air, soil, and sediments, often as a result of industrial processes and vehicle emissions. Its presence in biological systems raises concerns due to its ability to form DNA adducts, which can lead to mutagenic effects. The substance is often studied in the context of environmental health and toxicology, particularly regarding its role in cancer risk assessment. Analytical methods such as high-performance liquid chromatography (HPLC) are commonly employed to detect and quantify this compound in environmental samples.
Formula:C20H12O
InChI:InChI=1S/C20H12O/c21-18-10-7-12-5-6-14-11-13-3-1-2-4-15(13)16-8-9-17(18)19(12)20(14)16/h1-11,21H
InChI key:InChIKey=GPIRWWPRDKGKPS-UHFFFAOYSA-N
SMILES:OC=1C=2C3=C4C(C=5C(C=C4C=CC3=CC1)=CC=CC5)=CC2
Synonyms:- Benzo[a]pyren-1-ol
- 1-Hydroxybenzo[a]pyrene
- 1-Hydroxybenzo(a)pyrene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Hydroxybenzo[a]pyrene
CAS:Controlled ProductFormula:C20H12OColor and Shape:NeatMolecular weight:268.309
