CAS 1334500-02-5

3′-Cyano[1,1′-biphenyl]-3-acetic acid

Description:

3′-Cyano[1,1′-biphenyl]-3-acetic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a cyano group (-CN) at the 3' position and a carboxylic acid group (-COOH) at the 3 position of the biphenyl framework contributes to its chemical reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the polar functional groups. Its molecular structure suggests potential for various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in organic synthesis and materials science. Additionally, the cyano group can enhance the electronic properties of the molecule, potentially making it useful in electronic applications or as a building block in the synthesis of more complex organic compounds. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₅H₁₁NO₂

InChI: InChI=1S/C15H11NO2/c16-10-12-4-2-6-14(8-12)13-5-1-3-11(7-13)9-15(17)18/h1-8H,9H2,(H,17,18)

InChI key: InChIKey=HMYJGENGCMXDLR-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C=C(C=CC1)C2=CC(C#N)=CC=C2

Synonyms:

• 3′-Cyano[1,1′-biphenyl]-3-acetic acid
• [1,1′-Biphenyl]-3-acetic acid, 3′-cyano-

[3-(3-cyanophenyl)phenyl]acetic acid

CAS: 1334500-02-5

Formula: C₁₅H₁₁NO₂

Molecular weight: 237.2533

Ref: IN-DA0072N0