CAS 1334500-03-6
:3′,5′-Dimethyl[1,1′-biphenyl]-3-acetic acid
Description:
3′,5′-Dimethyl[1,1′-biphenyl]-3-acetic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two methyl groups at the 3′ and 5′ positions of one of the phenyl rings contributes to its unique properties, including increased hydrophobicity and potential steric effects. The acetic acid functional group at the 3-position introduces acidity and polar characteristics, making the compound more soluble in polar solvents compared to non-polar solvents. This compound may exhibit biological activity, potentially influencing various biochemical pathways, although specific biological data may vary. Its molecular structure suggests potential applications in pharmaceuticals or as a chemical intermediate in organic synthesis. As with many organic compounds, safety data should be consulted to understand its handling and toxicity. Overall, the compound's unique structural features and functional groups contribute to its chemical behavior and potential applications in various fields.
Formula:C16H16O2
InChI:InChI=1S/C16H16O2/c1-11-6-12(2)8-15(7-11)14-5-3-4-13(9-14)10-16(17)18/h3-9H,10H2,1-2H3,(H,17,18)
InChI key:InChIKey=OEYCTWRGFOPQOG-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=C(C=CC1)C2=CC(C)=CC(C)=C2
Synonyms:- [1,1′-Biphenyl]-3-acetic acid, 3′,5′-dimethyl-
- 3′,5′-Dimethyl[1,1′-biphenyl]-3-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
