CAS 1334500-04-7
:Benzaldehyde, 3-(4-amino-2-pyridinyl)-, hydrochloride (1:1)
Description:
Benzaldehyde, 3-(4-amino-2-pyridinyl)-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a benzaldehyde moiety and a pyridine ring with an amino group. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form. The presence of the amino group on the pyridine ring enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its applications may extend to pharmaceuticals, where it could serve as an intermediate in the synthesis of biologically active compounds. The hydrochloride form indicates that it is a salt, which often improves stability and solubility in aqueous solutions. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled. Overall, this compound exemplifies the intersection of organic chemistry and medicinal chemistry, with potential implications in drug development and synthesis.
Formula:C12H10N2O·ClH
InChI:InChI=1S/C12H10N2O.ClH/c13-11-4-5-14-12(7-11)10-3-1-2-9(6-10)8-15;/h1-8H,(H2,13,14);1H
InChI key:InChIKey=PIWWFSDCXGKVOC-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(C=CC1)C2=CC(N)=CC=N2.Cl
Synonyms:- Benzaldehyde, 3-(4-amino-2-pyridinyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
