CAS 1334500-07-0
:2′-Chloro-5′-methoxy[1,1′-biphenyl]-4-acetic acid
Description:
2′-Chloro-5′-methoxy[1,1′-biphenyl]-4-acetic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 2′ position and a methoxy group at the 5′ position on one of the phenyl rings contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The acetic acid functional group at the 4-position introduces acidity to the molecule, allowing it to participate in various chemical reactions, such as esterification or amidation. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could interact with biological targets, potentially influencing its pharmacokinetic and pharmacodynamic profiles. Additionally, the presence of halogen and methoxy substituents can affect the compound's lipophilicity and overall stability. As with many organic compounds, its behavior in different solvents and under varying conditions can provide insights into its potential applications in medicinal chemistry or material science.
Formula:C15H13ClO3
InChI:InChI=1S/C15H13ClO3/c1-19-12-6-7-14(16)13(9-12)11-4-2-10(3-5-11)8-15(17)18/h2-7,9H,8H2,1H3,(H,17,18)
InChI key:InChIKey=HOGDZTPEZJGOOR-UHFFFAOYSA-N
SMILES:ClC=1C(=CC(OC)=CC1)C2=CC=C(CC(O)=O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-acetic acid, 2′-chloro-5′-methoxy-
- 2′-Chloro-5′-methoxy[1,1′-biphenyl]-4-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
