CAS 1334500-08-1
:3′-Fluoro-4′-methoxy[1,1′-biphenyl]-4-acetic acid
Description:
3′-Fluoro-4′-methoxy[1,1′-biphenyl]-4-acetic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 3′ position and a methoxy group at the 4′ position on one of the phenyl rings contributes to its unique chemical properties, including potential variations in polarity and reactivity. The acetic acid functional group at the 4-position introduces acidity to the molecule, allowing it to participate in various chemical reactions, such as esterification or amidation. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. Additionally, the presence of halogen and methoxy substituents can influence the compound's solubility and interaction with biological systems. Overall, 3′-Fluoro-4′-methoxy[1,1′-biphenyl]-4-acetic acid is a versatile compound with potential implications in various fields of chemistry and biology.
Formula:C15H13FO3
InChI:InChI=1S/C15H13FO3/c1-19-14-7-6-12(9-13(14)16)11-4-2-10(3-5-11)8-15(17)18/h2-7,9H,8H2,1H3,(H,17,18)
InChI key:InChIKey=WRPFETSVTXXKIL-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1OC)C2=CC=C(CC(O)=O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-acetic acid, 3′-fluoro-4′-methoxy-
- 3′-Fluoro-4′-methoxy[1,1′-biphenyl]-4-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(3'-Fluoro-4'-methoxy-[1,1'-biphenyl]-4-yl)acetic acid
CAS:Formula:C15H13FO3Molecular weight:260.2603
