CAS 1334500-12-7
:4′-[(Dimethylamino)carbonyl][1,1′-biphenyl]-3-acetic acid
Description:
4′-[(Dimethylamino)carbonyl][1,1′-biphenyl]-3-acetic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a dimethylamino group indicates that the compound has basic properties, as this group can donate electrons. The carbonyl functionality contributes to the compound's reactivity, allowing it to participate in various chemical reactions, such as nucleophilic attacks. The acetic acid moiety suggests that the compound can act as a weak acid, capable of donating a proton in solution. This compound may exhibit interesting biological activities due to its structural features, making it a potential candidate for pharmaceutical applications. Its solubility, stability, and reactivity can be influenced by the presence of the dimethylamino and carboxylic acid groups, which can also affect its interactions with other molecules. Overall, this compound's unique structure and functional groups contribute to its potential utility in various chemical and biological contexts.
Formula:C17H17NO3
InChI:InChI=1S/C17H17NO3/c1-18(2)17(21)14-8-6-13(7-9-14)15-5-3-4-12(10-15)11-16(19)20/h3-10H,11H2,1-2H3,(H,19,20)
InChI key:InChIKey=XOQRNTYBJLLYRH-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=C(C=CC1)C2=CC=C(C(N(C)C)=O)C=C2
Synonyms:- [1,1′-Biphenyl]-3-acetic acid, 4′-[(dimethylamino)carbonyl]-
- 4′-[(Dimethylamino)carbonyl][1,1′-biphenyl]-3-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(4'-(Dimethylcarbamoyl)-[1,1'-biphenyl]-3-yl)acetic acid
CAS:Formula:C17H17NO3Molecular weight:283.3218
