CymitQuimica logo

CAS 1334500-13-8

:

3′-Fluoro-5′-(methoxycarbonyl)[1,1′-biphenyl]-3-acetic acid

Description:
3′-Fluoro-5′-(methoxycarbonyl)[1,1′-biphenyl]-3-acetic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 3′ position and a methoxycarbonyl group at the 5′ position contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The acetic acid functional group indicates that the compound can exhibit acidic behavior, which may influence its interactions in various chemical environments. This compound may be of interest in pharmaceutical research and organic synthesis due to its structural features, which could impart specific biological activities or facilitate the development of novel materials. Its CAS number, 1334500-13-8, allows for precise identification in chemical databases, aiding in the study and application of this substance in various scientific fields. Overall, the combination of functional groups and the biphenyl framework suggests a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C16H13FO4
InChI:InChI=1S/C16H13FO4/c1-21-16(20)13-7-12(8-14(17)9-13)11-4-2-3-10(5-11)6-15(18)19/h2-5,7-9H,6H2,1H3,(H,18,19)
InChI key:InChIKey=HIOCVUACDVZVFC-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(C=C(F)C1)C2=CC(CC(O)=O)=CC=C2
Synonyms:
  • 3′-Fluoro-5′-(methoxycarbonyl)[1,1′-biphenyl]-3-acetic acid
  • [1,1′-Biphenyl]-3-acetic acid, 3′-fluoro-5′-(methoxycarbonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.