CAS 1334512-40-1

Pyrrolidine, 3-[4-(trifluoromethyl)phenyl]-, hydrochloride (1:1), (3R)-

Description:

Pyrrolidine, 3-[4-(trifluoromethyl)phenyl]-, hydrochloride (1:1), (3R)- is a chemical compound characterized by its pyrrolidine core, which is a five-membered saturated heterocyclic amine. The presence of a trifluoromethyl group attached to a phenyl ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The (3R)- designation indicates the specific stereochemistry at the pyrrolidine ring, which can be crucial for its interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its trifluoromethyl substitution can also impart unique reactivity and stability characteristics, making it a valuable scaffold in drug design. Overall, the combination of its structural features and stereochemistry contributes to its potential utility in various chemical and biological applications.

Formula: C₁₁H₁₂F₃N·ClH

InChI: InChI=1S/C11H12F3N.ClH/c12-11(13,14)10-3-1-8(2-4-10)9-5-6-15-7-9;/h1-4,9,15H,5-7H2;1H/t9-;/m0./s1

InChI key: InChIKey=SZXUAAODEDSBMB-FVGYRXGTSA-N

SMILES: C(F)(F)(F)C1=CC=C(C=C1)[C@H]2CCNC2.Cl

Synonyms:

• Pyrrolidine, 3-[4-(trifluoromethyl)phenyl]-, hydrochloride (1:1), (3R)-