CymitQuimica logo

CAS 1334607-81-6

:

2-(1-Methylethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyridine

Description:
2-(1-Methylethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyridine is a complex organic compound characterized by its unique functional groups and structural features. This substance contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, contributing to its basicity and potential reactivity. The presence of a trifluoromethyl group enhances its lipophilicity and can influence its electronic properties, making it useful in various chemical applications. Additionally, the compound features a dioxaborolane moiety, which is known for its role in boron chemistry, particularly in organoboron compounds that are valuable in synthetic organic chemistry and materials science. The methylethoxy group adds steric bulk and can affect the solubility and reactivity of the compound. Overall, this substance is likely to exhibit interesting chemical behavior, making it a candidate for research in fields such as medicinal chemistry, agrochemicals, or materials development. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods.
Formula:C15H21BF3NO3
InChI:InChI=1S/C15H21BF3NO3/c1-9(2)21-12-11(15(17,18)19)7-10(8-20-12)16-22-13(3,4)14(5,6)23-16/h7-9H,1-6H3
InChI key:InChIKey=ILSFYCBFQZKMJN-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(C(F)(F)F)C(OC(C)C)=NC2
Synonyms:
  • 2-Propan-2-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyridine
  • Pyridine, 2-(1-methylethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-
  • 2-(1-Methylethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyridine
  • 2-Isopropoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.