CAS 13347-77-8
:N-cbz-gly-gly-leu
Description:
N-Cbz-gly-gly-leu, also known as N-carbobenzyloxy-glycyl-glycyl-leucine, is a peptide derivative characterized by its structure, which includes the amino acids glycine and leucine. The "N-Cbz" designation indicates that the amino group of the first glycine is protected by a carbobenzyloxy (Cbz) group, which is commonly used in peptide synthesis to prevent unwanted reactions. This compound is typically utilized in biochemical research and peptide synthesis due to its role as a building block for more complex peptides. Its properties include solubility in organic solvents and moderate stability under standard laboratory conditions. The presence of the leucine residue contributes to hydrophobic characteristics, influencing the compound's interactions in biological systems. Additionally, the Cbz protecting group can be removed under specific conditions, allowing for further functionalization or incorporation into larger peptide chains. Overall, N-Cbz-gly-gly-leu serves as a valuable intermediate in the synthesis of biologically active peptides.
Formula:C18H25N3O6
InChI:InChI=1/C18H25N3O6/c1-12(2)8-14(17(24)25)21-16(23)10-19-15(22)9-20-18(26)27-11-13-6-4-3-5-7-13/h3-7,12,14H,8-11H2,1-2H3,(H,19,22)(H,20,26)(H,21,23)(H,24,25)
SMILES:CC(C)CC(C(=O)O)N=C(CN=C(CN=C(O)OCc1ccccc1)O)O
Synonyms:- Z-Gly-Gly-Leu-OH
- N-[(benzyloxy)carbonyl]glycylglycylleucine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Z-Gly-Gly-Leu-OH
CAS:Glycylglycine is a hydrophobic amino acid that is found in collagen and other proteins. It has been shown to inhibit the activity of proteinases such as chymotrypsin, trypsin, and elastase, which are enzymes that break down proteins. Glycylglycine is a fluorescent molecule that can be detected by fluorescence microscopy and has been used in the study of protein-protein interactions. Glycylglycine is an acidic amino acid with an amino acid composition that consists of about 20% glycine, 40% hydroxyphenylalanine, 30% serine and 10% threonine. The spatial specificity of this compound has been studied using sephacryl electrophoresis, which showed it was localized to the extracellular matrix and in cell culture supernatants. Aminocoumarins are glycylglycines with an attached aminocoumarin group. Hydrolysis of glyFormula:C18H25N3O6Purity:Min. 95%Molecular weight:379.41 g/mol


