
CAS 1334784-81-4
:1,1-Dimethylethyl α-cyano-5-methoxy-2-pyridineacetate
Description:
1,1-Dimethylethyl α-cyano-5-methoxy-2-pyridineacetate, identified by its CAS number 1334784-81-4, is a chemical compound that features a pyridine ring substituted with a methoxy group and an α-cyano group. This compound is characterized by its unique structural features, which contribute to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the dimethyl group enhances its steric properties, potentially influencing its reactivity and interaction with biological targets. The methoxy group can affect the compound's solubility and polarity, while the cyano group may impart specific electronic properties, making it a candidate for further chemical modifications. Additionally, the pyridine moiety is known for its role in coordination chemistry and as a building block in the synthesis of more complex organic molecules. Overall, this compound's distinct functional groups and structural characteristics suggest it may exhibit interesting biological or chemical activity, warranting further investigation.
Formula:C13H16N2O3
InChI:InChI=1S/C13H16N2O3/c1-13(2,3)18-12(16)10(7-14)11-6-5-9(17-4)8-15-11/h5-6,8,10H,1-4H3
InChI key:InChIKey=VDEHVFMUFROQJT-UHFFFAOYSA-N
SMILES:C(C(OC(C)(C)C)=O)(C#N)C1=CC=C(OC)C=N1
Synonyms:- 1,1-Dimethylethyl α-cyano-5-methoxy-2-pyridineacetate
- 2-Pyridineacetic acid, α-cyano-5-methoxy-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.