CymitQuimica logo

CAS 1335013-59-6

:

2,2,2-Trifluoro-1-[3-(trifluoromethoxy)phenyl]ethanone

Description:
2,2,2-Trifluoro-1-[3-(trifluoromethoxy)phenyl]ethanone is a synthetic organic compound characterized by its trifluoromethyl and trifluoromethoxy functional groups, which contribute to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It has a relatively high molecular weight and exhibits significant lipophilicity due to the presence of multiple fluorine atoms, which can enhance its stability and reactivity in various chemical environments. The trifluoromethyl groups are known to impart strong electron-withdrawing characteristics, influencing the compound's reactivity and interaction with biological systems. Additionally, this compound may exhibit interesting properties such as low volatility and high thermal stability, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. However, due to the presence of fluorinated groups, it is essential to handle this substance with care, considering its potential environmental and health impacts.
Formula:C9H4F6O2
InChI:InChI=1S/C9H4F6O2/c10-8(11,12)7(16)5-2-1-3-6(4-5)17-9(13,14)15/h1-4H
InChI key:InChIKey=BVYXSEPMIUBRDB-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1=CC(OC(F)(F)F)=CC=C1
Synonyms:
  • 2,2,2-Trifluoro-1-[3-(trifluoromethoxy)phenyl]ethanone
  • 2,2,2-Trifluoro-1-[3-(trifluoromethoxy)phenyl]ethan-1-one
  • Ethanone, 2,2,2-trifluoro-1-[3-(trifluoromethoxy)phenyl]-
  • 3′-(Trifluoromethoxy)-2,2,2-trifluoroacetophenone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.