
CAS 133502-50-8
:4,4′-[(4-Imino-2,5-cyclohexadien-1-ylidene)methylene]bis[N,N-dimethylbenzenamine]
Description:
4,4′-[(4-Imino-2,5-cyclohexadien-1-ylidene)methylene]bis[N,N-dimethylbenzenamine], with the CAS number 133502-50-8, is an organic compound characterized by its complex structure that includes a central imino group and two N,N-dimethylbenzenamine moieties. This compound features a cyclohexadiene framework, which contributes to its potential reactivity and stability. The presence of the imino group suggests that it may participate in various chemical reactions, including condensation and nucleophilic addition. The dimethylamino groups enhance its solubility in organic solvents and may influence its electronic properties, making it a candidate for applications in dyes, pigments, or as a precursor in organic synthesis. Additionally, the compound's unique structure may impart specific optical or electronic characteristics, which could be explored in materials science or medicinal chemistry. However, detailed studies on its physical properties, reactivity, and potential applications would be necessary to fully understand its behavior in various chemical contexts.
Formula:C23H25N3
InChI:InChI=1S/C23H25N3/c1-25(2)21-13-7-18(8-14-21)23(17-5-11-20(24)12-6-17)19-9-15-22(16-10-19)26(3)4/h5-16,24H,1-4H3
InChI key:InChIKey=XYSSGYHHAUSTHC-UHFFFAOYSA-N
SMILES:C(C1=CC=C(N(C)C)C=C1)(C2=CC=C(N(C)C)C=C2)=C3C=CC(=N)C=C3
Synonyms:- 4,4′-[(4-Imino-2,5-cyclohexadien-1-ylidene)methylene]bis[N,N-dimethylbenzenamine]
- N,N,N′,N′-Tetramethylpararosaniline
- Benzenamine, 4,4′-[(4-imino-2,5-cyclohexadien-1-ylidene)methylene]bis[N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
